CAS 75443-62-8 is the registry number for (R)–benzyl 2,5–dioxotetrahydrofuran–3–ylcarbamate. Offered by: GLPBio. Available pack sizes: 1g.
Benzyl N-[(3R)-2,5-dioxooxolan-3-yl]carbamate (CAS 75443-62-8) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: benzyl N-[(3R)-2,5-dioxooxolan-3-yl]carbamate. InChIKey: OZPYEGOBGWQOSZ-SECBINFHSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | benzyl N-[(3R)-2,5-dioxooxolan-3-yl]carbamate |
| InChIKey | OZPYEGOBGWQOSZ-SECBINFHSA-N |
| SMILES | C1[C@H](C(=O)OC1=O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)