CAS 500349-81-5 is the registry number for 4-Hydroxy-5,8-dimethoxyquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
5,8-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid (CAS 500349-81-5) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 5,8-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: UMRUDNVGDOZXDW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 5,8-dimethoxy-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | UMRUDNVGDOZXDW-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)OC)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)