CAS 4515-23-5 appears in our catalog under these names: N-Cbz-L-aspartic anhydride, 95%, Cbz-L-Aspartic anhydride, 98%, N-Z-L-ASPARTIC ANHYDRIDE, 95%, Cbz-L-Aspartic anhydride, 97%, 97%, Cbz-L-Aspartic anhydride. Offered by: Combi-blocks, AmBeed, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 25g, 5g, 1g, 5 g, 10 g, 25 g.
Benzyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate (CAS 4515-23-5) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: benzyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate. InChIKey: OZPYEGOBGWQOSZ-VIFPVBQESA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | benzyl N-[(3S)-2,5-dioxooxolan-3-yl]carbamate |
| InChIKey | OZPYEGOBGWQOSZ-VIFPVBQESA-N |
| SMILES | C1[C@@H](C(=O)OC1=O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)