CAS 858769-50-3 is the registry number for 3-Formyl-5,6-dimethoxy-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-formyl-5,6-dimethoxy-1H-indole-2-carboxylic acid (CAS 858769-50-3) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 3-formyl-5,6-dimethoxy-1H-indole-2-carboxylic acid. InChIKey: QVAZMCCSENVCPR-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 3-formyl-5,6-dimethoxy-1H-indole-2-carboxylic acid |
| InChIKey | QVAZMCCSENVCPR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C(N2)C(=O)O)C=O)OC |
Computed by PubChem (NCBI)