Products 858769-50-3

CAS 858769-50-3 is the registry number for 3-Formyl-5,6-dimethoxy-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-formyl-5,6-dimethoxy-1H-indole-2-carboxylic acid (CAS 858769-50-3) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 3-formyl-5,6-dimethoxy-1H-indole-2-carboxylic acid. InChIKey: QVAZMCCSENVCPR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO5
Molecular weight249.22 g/mol
IUPAC name3-formyl-5,6-dimethoxy-1H-indole-2-carboxylic acid
InChIKeyQVAZMCCSENVCPR-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C(=C1)C(=C(N2)C(=O)O)C=O)OC

Computed by PubChem (NCBI)