CAS 953752-64-2 appears in our catalog under these names: 5-(2,5-Dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid, 95%, 5-(2,5-Dimethoxyphenyl)isoxazole-3-carboxylic acid, 97%, 5-(2,5-Dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid (CAS 953752-64-2) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: SHKJDWPURNWNTI-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | SHKJDWPURNWNTI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)