CAS 125814-23-5 appears in our catalog under these names: Z-L-Alanine n-carboxyanhydride, 95%, N-Cbz-L-alanine N-carboxyanhydride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g.
Benzyl (4S)-4-methyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate (CAS 125814-23-5) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: benzyl (4S)-4-methyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate. InChIKey: PSOXFYKJSWSUAG-QMMMGPOBSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | benzyl (4S)-4-methyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate |
| InChIKey | PSOXFYKJSWSUAG-QMMMGPOBSA-N |
| SMILES | C[C@H]1C(=O)OC(=O)N1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)