CAS 38678-58-9 appears in our catalog under these names: Phenoxyacetic acid N-hydroxysuccinimide ester, 96%, Phenoxyacetic acid N-hydroxysuccinimide ester, Phenoxyacetic acid N-hydroxysuccinimide ester, 95%, 95%, 2,5-Dioxopyrrolidin-1-yl 2-phenoxyacetate, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 50mg, 100mg, 500mg, 1000mg.
(2,5-dioxopyrrolidin-1-yl) 2-phenoxyacetate (CAS 38678-58-9) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-phenoxyacetate. InChIKey: SMBVSRKAVRAVKU-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-phenoxyacetate |
| InChIKey | SMBVSRKAVRAVKU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)COC2=CC=CC=C2 |
Computed by PubChem (NCBI)