CAS 69676-65-9 appears in our catalog under these names: 2-(2-(1,3-Dioxoisoindolin-2-yl)ethoxy)acetic acid, 95%, 2-(2-Phthalimidoethoxy)acetic acid, 97% , 2-(2-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)ethoxy)acetic acid. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 5g, 2,5g.
2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]acetic acid (CAS 69676-65-9) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]acetic acid. InChIKey: PHZYUQLIZKTSJE-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]acetic acid |
| InChIKey | PHZYUQLIZKTSJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCOCC(=O)O |
Computed by PubChem (NCBI)