Products 1947408-74-3
CAS 1947408-74-3 appears in our catalog under these names: Cysteine thiol probe/ 97.01% (existing batch purity), Cysteine thiol probe, Cysteine thiol probe, Cysteine thiol probe, 98.55%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 2mg.
Methyl (2R)-2-[(4-bromobenzoyl)amino]-3-sulfanylpropanoate (CAS 1947408-74-3) is a chemical compound with the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. IUPAC name: methyl (2R)-2-[(4-bromobenzoyl)amino]-3-sulfanylpropanoate. InChIKey: QLAHQHTYCQKQLI-VIFPVBQESA-N.
| Molecular formula | C11H12BrNO3S |
|---|---|
| Molecular weight | 318.19 g/mol |
| IUPAC name | methyl (2R)-2-[(4-bromobenzoyl)amino]-3-sulfanylpropanoate |
| InChIKey | QLAHQHTYCQKQLI-VIFPVBQESA-N |
| SMILES | COC(=O)[C@H](CS)NC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)