Products 1301706-58-0
CAS 1301706-58-0 appears in our catalog under these names: (R)-3,6-Diamino-6-oxohexanoic acid hydrochloride 95%, (R)-3,6-Diamino-6-oxohexanoic acid hydrochloride, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(3R)-3,6-diamino-6-oxohexanoic acid;hydrochloride (CAS 1301706-58-0) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: (3R)-3,6-diamino-6-oxohexanoic acid;hydrochloride. InChIKey: UCMJADDIUIIUTC-PGMHMLKASA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | (3R)-3,6-diamino-6-oxohexanoic acid;hydrochloride |
| InChIKey | UCMJADDIUIIUTC-PGMHMLKASA-N |
| SMILES | C(CC(=O)N)[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
D-beta-homoglutamine-HCl, (R)-3,6-Diamino-6-oxohexanoic acid hydrochloride, (3R)-3,6-diamino-6-oxohexanoic acid;hydrochloride, starbld0017880, (S)-3,6-Diamino-6-oxohexanoic acid hydrochloride, (3R)-3,6-diamino-6-oxo-hexanoic acid;hydrochloride, D-beta-Homoglutamine hydrochloride, UCMJADDIUIIUTC-PGMHMLKASA-N, (3R)-3-amino-5-carbamoylpentanoic acid hydrochloride