Products 59095-76-0
CAS 59095-76-0 is the registry number for H–GLY–ALA–OME HCL. Offered by: GLPBio. Available pack sizes: 25g, 5g.
Methyl (2S)-2-[(2-aminoacetyl)amino]propanoate;hydrochloride (CAS 59095-76-0) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: methyl (2S)-2-[(2-aminoacetyl)amino]propanoate;hydrochloride. InChIKey: MRSZXYSIBHQNOR-WCCKRBBISA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | methyl (2S)-2-[(2-aminoacetyl)amino]propanoate;hydrochloride |
| InChIKey | MRSZXYSIBHQNOR-WCCKRBBISA-N |
| SMILES | C[C@@H](C(=O)OC)NC(=O)CN.Cl |
Computed by PubChem (NCBI)