Products 55720-26-8
CAS 55720-26-8 appears in our catalog under these names: Aminoethoxyvinyl Glycine Hydrochloride, Aviglycine hydrochloride, Aminoethoxyvinyl Glycine (hydrochloride), AVG-Cl, 95.00%, (S)-trans-2-Amino-4-(2-aminoethoxy)-3-butenoic acid hydrochloride. Offered by: TRC, TargetMol, GLPBio, Chemat, Biosynth. Available pack sizes: 25mg, 1mg, 10mg, 5mg, 1000mg, 2000mg, 10 mg, 1 mg.
(E,2S)-2-amino-4-(2-aminoethoxy)but-3-enoic acid;hydrochloride (CAS 55720-26-8) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: (E,2S)-2-amino-4-(2-aminoethoxy)but-3-enoic acid;hydrochloride. InChIKey: ZDCPLYVEFATMJF-BTIOQYSDSA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | (E,2S)-2-amino-4-(2-aminoethoxy)but-3-enoic acid;hydrochloride |
| InChIKey | ZDCPLYVEFATMJF-BTIOQYSDSA-N |
| SMILES | C(CO/C=C/[C@@H](C(=O)O)N)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Aviglycine hydrochloride, (S)-trans-2-Amino-4-(2-aminoethoxy)-3-butenoic acid hydrochloride, RETAIN, 3-Butenoic acid, 2-amino-4-(2-aminoethoxy)-, monohydrochloride, (2S,3E)-, [s]-trans-2-amino-4-(2-aminoethoxy)-3-butenoic acid hydrochloride, Aminoethoxyvinyl glycine hydrochloride, Aviglycine hydrochloride [ISO], AVG-Cl, Aviglycine (hydrochloride), AVG-HCl