cas: 587-84-8 — see every product listed under this CAS number, including other names
Diphenylamine sulfate (CAS 587-84-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 500g. Offered by: GLPBio, Fluorochem.
| brand | GLPBio |
|---|---|
| catalog number | GD08725-100g |
| cas | 587-84-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 1439.53 Pln | |
| GLPBio | 25g | 760.86 Pln | |
| GLPBio | 5g | 545.55 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 284.29 Pln | |
| Fluorochem | 25g | 575.86 Pln | |
| Fluorochem | 100g | 1575.50 Pln | |
| Fluorochem | 500g | 7313.07 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N-phenylaniline;sulfuric acid (CAS 587-84-8) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: N-phenylaniline;sulfuric acid. InChIKey: IPZMDJYHJNHGML-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | N-phenylaniline;sulfuric acid |
| InChIKey | IPZMDJYHJNHGML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2.OS(=O)(=O)O |
Computed by PubChem (NCBI)