Products 1092353-03-1
CAS 1092353-03-1 appears in our catalog under these names: Ethyl 2,3-dichloroisonicotinate, 95%, 2,3-Dichloropyridine-4-carboxylic acid ethyl ester, 97%, 97%, Ethyl 2,3-dichloroisonicotinate, 98%, Ethyl 2,3-dichloroisonicotinate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g.
Ethyl 2,3-dichloropyridine-4-carboxylate (CAS 1092353-03-1) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 2,3-dichloropyridine-4-carboxylate. InChIKey: YOOGHVYYXXTYTN-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 2,3-dichloropyridine-4-carboxylate |
| InChIKey | YOOGHVYYXXTYTN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NC=C1)Cl)Cl |
Computed by PubChem (NCBI)