cas: 866028-26-4 — see every product listed under this CAS number, including other names
Ethyl 2-(2-chlorobenzyl)acrylate (CAS 866028-26-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867077-10MG |
| cas | 866028-26-4 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10mg | 133.30 Pln | |
| Fluorochem | 50mg | 154.13 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate (CAS 866028-26-4) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate. InChIKey: VTAOWWAFBSFWSG-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate |
| InChIKey | VTAOWWAFBSFWSG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C)CC1=CC=CC=C1Cl |
Computed by PubChem (NCBI)