INF39 99%
cas: 866028-26-4 — see every product listed under this CAS number, including other names
INF39 99% (CAS 866028-26-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A601441-50mg |
| cas | 866028-26-4 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 203.50 Pln | |
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 921.06 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A601441 |
Ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate (CAS 866028-26-4) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate. InChIKey: VTAOWWAFBSFWSG-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate |
| InChIKey | VTAOWWAFBSFWSG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C)CC1=CC=CC=C1Cl |
Computed by PubChem (NCBI)