cas: 1999-00-4 — see every product listed under this CAS number, including other names
Ethyl 3-(4-fluorophenyl)-3-oxopropanoate 96% (CAS 1999-00-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A134139-1g |
| cas | 1999-00-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 325.88 Pln | |
| Ambeed | 100g | 893.25 Pln | |
| Ambeed | 500g | 4175.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A134139 |
Ethyl 3-(4-fluorophenyl)-3-oxopropanoate (CAS 1999-00-4) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: ethyl 3-(4-fluorophenyl)-3-oxopropanoate. InChIKey: SJUXLKYJKQBZLM-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | ethyl 3-(4-fluorophenyl)-3-oxopropanoate |
| InChIKey | SJUXLKYJKQBZLM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)