cas: 1309933-04-7 — see every product listed under this CAS number, including other names
Ethyl 3-bromo-2,6-difluorobenzoate, 98%, 98% (CAS 1309933-04-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FE5K-100mg |
| cas | 1309933-04-7 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 606.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-bromo-2,6-difluorobenzoate (CAS 1309933-04-7) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 3-bromo-2,6-difluorobenzoate. InChIKey: LKIQAXWEIBVROY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | ethyl 3-bromo-2,6-difluorobenzoate |
| InChIKey | LKIQAXWEIBVROY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1F)Br)F |
Computed by PubChem (NCBI)