cas: 401566-69-6 — see every product listed under this CAS number, including other names
Ethyl 5,6-Dichloronicotinate, >98.0%(GC) (CAS 401566-69-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2772-5G |
| cas | 401566-69-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 565.81 Pln | |
| TCI | 25g | 2109.83 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
Ethyl 5,6-dichloropyridine-3-carboxylate (CAS 401566-69-6) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 5,6-dichloropyridine-3-carboxylate. InChIKey: WGQSPCCCBKQNEV-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 5,6-dichloropyridine-3-carboxylate |
| InChIKey | WGQSPCCCBKQNEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1)Cl)Cl |
Computed by PubChem (NCBI)