cas: 401566-69-6 — see every product listed under this CAS number, including other names
Ethyl 5,6-Dichloronicotinate, 98%, 98% (CAS 401566-69-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114M0S-250mg |
| cas | 401566-69-6 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 482.00 Pln | |
| Chemat | 10g | 890.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5,6-dichloropyridine-3-carboxylate (CAS 401566-69-6) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 5,6-dichloropyridine-3-carboxylate. InChIKey: WGQSPCCCBKQNEV-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 5,6-dichloropyridine-3-carboxylate |
| InChIKey | WGQSPCCCBKQNEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1)Cl)Cl |
Computed by PubChem (NCBI)