cas: 35661-38-2 — see every product listed under this CAS number, including other names
FMOC-DL-ALA-OH, 98%, 98% (CAS 35661-38-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C81L-5g |
| cas | 35661-38-2 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 347.60 Pln | |
| Chemat | 10g | 98.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 35661-38-2) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QWXZOFZKSQXPDC-UHFFFAOYSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)