CAS 865720-15-6 appears in our catalog under these names: N-Fmoc-L-alanine-13C3, 15N, (((9H-Fluoren-9-yl)methoxy)carbonyl)-L-alanine-13C3-15N, 95%, 95%, Fmoc-Ala-OH-13C3,15N, 99.9%, Fmoc-Ala-OH-13C3,15N, 95%. Offered by: TRC, Chemat, MedChemExpress, Ambeed. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 1g, 100mg, 250mg, 5 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)(1,2,3-13C3)propanoic acid (CAS 865720-15-6) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 315.30 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)(1,2,3-13C3)propanoic acid. InChIKey: QWXZOFZKSQXPDC-SCMTXWLBSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 315.30 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)(1,2,3-13C3)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-SCMTXWLBSA-N |
| SMILES | [13CH3][13C@@H]([13C](=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)