Products 117398-49-9
CAS 117398-49-9 appears in our catalog under these names: Fmoc–Ala–OH–15N, FMOC-ALA-OH-15N, 98 ATOM % 15N, Fmoc-Ala-OH-15N, ≥10 atom% 15N,≥98%, ≥10 atom% 15N,≥98%, Fmoc-Ala-OH-15N, 99%, FMOC-ALA-OH-15N, ≥10 atom% 15N,≥98%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 25 mg, 10 mg, 500 mg, 100 mg, 50 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)propanoic acid (CAS 117398-49-9) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 312.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)propanoic acid. InChIKey: QWXZOFZKSQXPDC-DKOIJTIKSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-DKOIJTIKSA-N |
| SMILES | C[C@@H](C(=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)