Products 225101-64-4
CAS 225101-64-4 appears in our catalog under these names: L-Alanine-2-d1-N-FMOC, 98 atom % D, min 98% Chemical Purity, Fmoc-Ala-OH-d1. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 50 mg, 100 mg, 25 mg.
(2R)-2-deuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 225101-64-4) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 312.3 g/mol. IUPAC name: (2R)-2-deuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QWXZOFZKSQXPDC-GYPYJKACSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | (2R)-2-deuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-GYPYJKACSA-N |
| SMILES | [2H][C@@](C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)