CAS 225101-67-7 appears in our catalog under these names: L-Alanine-3,3,3-d3-N-FMOC, 99 atom % D, min 98% Chemical Purity, FMOC-ALA-OH-3,3,3-D3, 99 ATOM % D, Fmoc-Ala-OH-3,3,3-d3, 99.84%. Offered by: CDN, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1G, 50 mg, 10 mg, 25 mg, 100 mg.
(2S)-3,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 225101-67-7) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 314.3 g/mol. IUPAC name: (2S)-3,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QWXZOFZKSQXPDC-DCLJDFQTSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | (2S)-3,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-DCLJDFQTSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)