cas: 181954-34-7 — see every product listed under this CAS number, including other names
Fmoc–Dap–OH (CAS 181954-34-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GA11336-1000 |
| cas | 181954-34-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 863.83 Pln | |
| GLPBio | 100g | 5380.51 Pln | |
| GLPBio | 25g | 2235.21 Pln | |
| GLPBio | 5g | 1299.11 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 181954-34-7) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HDSLKWZYHRLRRL-INIZCTEOSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HDSLKWZYHRLRRL-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)