cas: 181954-34-7 — see every product listed under this CAS number, including other names
Fmoc-Dap-OH, 95% (CAS 181954-34-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236731-1G |
| cas | 181954-34-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 351.98 Pln | |
| Fluorochem | 10g | 638.33 Pln | |
| Fluorochem | 25g | 1221.46 Pln | |
| Fluorochem | 100g | 4090.24 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 181954-34-7) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HDSLKWZYHRLRRL-INIZCTEOSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HDSLKWZYHRLRRL-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)