cas: 252049-06-2 — see every product listed under this CAS number, including other names
Fmoc–N–Me–Thr–OH (CAS 252049-06-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GA21750-1000 |
| cas | 252049-06-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 934.04 Pln | |
| GLPBio | 10g | 1280.39 Pln | |
| GLPBio | 25g | 1879.50 Pln | |
| GLPBio | 5g | 1088.49 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid (CAS 252049-06-2) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid. InChIKey: YBKRZKSVPNEMQK-XIKOKIGWSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid |
| InChIKey | YBKRZKSVPNEMQK-XIKOKIGWSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)