cas: 252049-06-2 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Thr-OH 98% (CAS 252049-06-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A154318-100mg |
| cas | 252049-06-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1366.06 Pln | |
| Ambeed | 100g | 5237.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A154318 |
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid (CAS 252049-06-2) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid. InChIKey: YBKRZKSVPNEMQK-XIKOKIGWSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid |
| InChIKey | YBKRZKSVPNEMQK-XIKOKIGWSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)