cas: 252049-06-2 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Thr-OH, 97%, 97% (CAS 252049-06-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113QX2-100mg |
| cas | 252049-06-2 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 530.00 Pln | |
| Chemat | 25g | 1226.00 Pln | |
| Chemat | 100g | 4715.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid (CAS 252049-06-2) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid. InChIKey: YBKRZKSVPNEMQK-XIKOKIGWSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid |
| InChIKey | YBKRZKSVPNEMQK-XIKOKIGWSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)