cas: 252049-06-2 — see every product listed under this CAS number, including other names
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-methyl-L-threonine, 99.87% (CAS 252049-06-2) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 10 g, 5 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W036329-1 g |
| cas | 252049-06-2 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 333.62 Pln | |
| MedChemExpress | 10 g | 839.82 Pln | |
| MedChemExpress | 5 g | 542.60 Pln | |
| MedChemExpress | 25 g | 1657.16 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.87% |
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid (CAS 252049-06-2) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid. InChIKey: YBKRZKSVPNEMQK-XIKOKIGWSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxybutanoic acid |
| InChIKey | YBKRZKSVPNEMQK-XIKOKIGWSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)