cas: 170642-28-1 — see every product listed under this CAS number, including other names
Fmoc-D-Gly(allyl)-OH 95% (CAS 170642-28-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A982634-100g |
| cas | 170642-28-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 3891.44 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1265.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A982634 |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid (CAS 170642-28-1) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid. InChIKey: YVBLQCANYSFEBN-GOSISDBHSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
| InChIKey | YVBLQCANYSFEBN-GOSISDBHSA-N |
| SMILES | C=CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)