cas: 181954-34-7 — see every product listed under this CAS number, including other names
Fmoc-Dap-OH 95% (CAS 181954-34-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A130208-500g |
| cas | 181954-34-7 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 18715.50 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1354.94 Pln | |
| Ambeed | 100g | 4731.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A130208 |
(2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 181954-34-7) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HDSLKWZYHRLRRL-INIZCTEOSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HDSLKWZYHRLRRL-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)