cas: 181954-34-7 — see every product listed under this CAS number, including other names
Fmoc-Dap-OH, 98%, 98% (CAS 181954-34-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11349U-100mg |
| cas | 181954-34-7 |
| size | 100mg |
| availability | 22.69g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 405.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 181954-34-7) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HDSLKWZYHRLRRL-INIZCTEOSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HDSLKWZYHRLRRL-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)