cas: 221124-57-8 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Abu(4)-OH 98% (CAS 221124-57-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A834122-250mg |
| cas | 221124-57-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 25g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A834122 |
4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid (CAS 221124-57-8) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid. InChIKey: FBMGMJCITYNTQX-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid |
| InChIKey | FBMGMJCITYNTQX-UHFFFAOYSA-N |
| SMILES | CN(CCCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)