CAS 18598-74-8 appears in our catalog under these names: L-Isoleucine Methyl Ester Hydrochloride, >95% (HPLC), H–Ile–OMe·HCl, H-L-Ile-OMe*HCl, L-Isoleucine methyl ester hydrochloride, 98+% , L-Isoleucine methyl ester hydrochloride. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 1g, 25g, 500g, 100g, 250g, 5g, 1000g.
Methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 18598-74-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: GGTBEWGOPAFTTH-GEMLJDPKSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | GGTBEWGOPAFTTH-GEMLJDPKSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)