cas: 32668-14-7 — see every product listed under this CAS number, including other names
L-GLUTAMINE METHYL ESTER HYDROCHLORIDE, 97%, 97% (CAS 32668-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148OI-100mg |
| cas | 32668-14-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 880.40 Pln | |
| Chemat | 25g | 3678.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2,5-diamino-5-oxopentanoate;hydrochloride (CAS 32668-14-7) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: methyl (2S)-2,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: HGYBXODOMJPMNO-WCCKRBBISA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | methyl (2S)-2,5-diamino-5-oxopentanoate;hydrochloride |
| InChIKey | HGYBXODOMJPMNO-WCCKRBBISA-N |
| SMILES | COC(=O)[C@H](CCC(=O)N)N.Cl |
Computed by PubChem (NCBI)