cas: 64231-55-6 — see every product listed under this CAS number, including other names
L-Phenylalanine, 4-fluoro-, methyl ester, hydrochloride (1:1), 95%, 95% (CAS 64231-55-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKQK-100mg |
| cas | 64231-55-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 357.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride (CAS 64231-55-6) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride. InChIKey: FHEHCZJLZDLUAW-FVGYRXGTSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride |
| InChIKey | FHEHCZJLZDLUAW-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)