cas: 1391389-21-1 — see every product listed under this CAS number, including other names
METHYL (2R)-2-AMINO-2-(4-BROMOPHENYL)ACETATE HCL, 95% (CAS 1391389-21-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F514394-100MG |
| cas | 1391389-21-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1106.92 Pln | |
| Fluorochem | 5g | 2137.81 Pln | |
| Fluorochem | 10g | 3632.07 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2R)-2-amino-2-(4-bromophenyl)acetate;hydrochloride (CAS 1391389-21-1) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl (2R)-2-amino-2-(4-bromophenyl)acetate;hydrochloride. InChIKey: CSBFDIDFULVKDP-DDWIOCJRSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(4-bromophenyl)acetate;hydrochloride |
| InChIKey | CSBFDIDFULVKDP-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)