CAS 1391389-21-1 appears in our catalog under these names: Methyl (2R)-2-amino-2-(4-bromophenyl)acetate hydrochloride, 98%, (R)–Methyl 2–amino–2–(4–bromophenyl)acetate hydrochloride, (R)-Methyl 2-amino-2-(4-bromophenyl)acetate HCl, H-D-Phg(4-Br)-OMe 95%, methyl (2R)-2-amino-2-(4-bromophenyl)acetate hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 2g, 5g, 10g.
Methyl (2R)-2-amino-2-(4-bromophenyl)acetate;hydrochloride (CAS 1391389-21-1) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl (2R)-2-amino-2-(4-bromophenyl)acetate;hydrochloride. InChIKey: CSBFDIDFULVKDP-DDWIOCJRSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(4-bromophenyl)acetate;hydrochloride |
| InChIKey | CSBFDIDFULVKDP-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)