cas: 1391528-74-7 — see every product listed under this CAS number, including other names
METHYL (2S)-2-AMINO-2-(4-BROMOPHENYL)ACETATE HCL, 95% (CAS 1391528-74-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F514393-100MG |
| cas | 1391528-74-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1445.34 Pln | |
| Fluorochem | 5g | 5214.85 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2S)-2-amino-2-(4-bromophenyl)acetate;hydrochloride (CAS 1391528-74-7) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl (2S)-2-amino-2-(4-bromophenyl)acetate;hydrochloride. InChIKey: CSBFDIDFULVKDP-QRPNPIFTSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(4-bromophenyl)acetate;hydrochloride |
| InChIKey | CSBFDIDFULVKDP-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)