cas: 2060594-38-7 — see every product listed under this CAS number, including other names
Methyl 1-isopropylpyrazolo[3,4-d]pyrimidine-6-carboxylate, 97%, 97% (CAS 2060594-38-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JW9M-100mg |
| cas | 2060594-38-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 1067.60 Pln | |
| Chemat | 500mg | 1494.80 Pln | |
| Chemat | 1g | 2205.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 1-propan-2-ylpyrazolo[3,4-d]pyrimidine-6-carboxylate (CAS 2060594-38-7) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: methyl 1-propan-2-ylpyrazolo[3,4-d]pyrimidine-6-carboxylate. InChIKey: LNDPCMNERGIYMX-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | methyl 1-propan-2-ylpyrazolo[3,4-d]pyrimidine-6-carboxylate |
| InChIKey | LNDPCMNERGIYMX-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=NC(=NC=C2C=N1)C(=O)OC |
Computed by PubChem (NCBI)