CAS 883546-40-5 appears in our catalog under these names: 7-tert-Butyl[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid, 95%, 7-(tert-Butyl)-(1,2,4)triazolo(1,5-a)pyrimidine-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid (CAS 883546-40-5) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid. InChIKey: PRAOSNPWIAYNEB-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 7-tert-butyl-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxylic acid |
| InChIKey | PRAOSNPWIAYNEB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC2=NC=NN12)C(=O)O |
Computed by PubChem (NCBI)