Products 1005205-35-5

CAS 1005205-35-5 is the registry number for 1-Methoxymethyl-1h-indazole-5-carboxylic acid hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(methoxymethyl)indazole-5-carbohydrazide (CAS 1005205-35-5) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 1-(methoxymethyl)indazole-5-carbohydrazide. InChIKey: RWTGBDVJVHMTSX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N4O2
Molecular weight220.23 g/mol
IUPAC name1-(methoxymethyl)indazole-5-carbohydrazide
InChIKeyRWTGBDVJVHMTSX-UHFFFAOYSA-N
SMILESCOCN1C2=C(C=C(C=C2)C(=O)NN)C=N1

Computed by PubChem (NCBI)