CAS 146552-66-1 appears in our catalog under these names: Z-Eda-n3, 95%, Z-EDA-N3. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 250mg, 1g, 5g, 25g.
Benzyl N-(2-azidoethyl)carbamate (CAS 146552-66-1) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: benzyl N-(2-azidoethyl)carbamate. InChIKey: PKZPDLNPHGAPRU-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | benzyl N-(2-azidoethyl)carbamate |
| InChIKey | PKZPDLNPHGAPRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCN=[N+]=[N-] |
Computed by PubChem (NCBI)