CAS 890091-79-9 is the registry number for 4-(4-Aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(4-aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione (CAS 890091-79-9) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 4-(4-aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione. InChIKey: JABGUZODAZFOCH-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 4-(4-aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione |
| InChIKey | JABGUZODAZFOCH-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C(=O)N1C)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)