CAS 1030477-07-6 is the registry number for 1-[2-(Methoxymethyl)-7-methyl[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[2-(methoxymethyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone (CAS 1030477-07-6) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 1-[2-(methoxymethyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone. InChIKey: WHGADUULBTXXOE-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 1-[2-(methoxymethyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone |
| InChIKey | WHGADUULBTXXOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC2=NC(=NN12)COC)C(=O)C |
Computed by PubChem (NCBI)