CAS 1001500-15-7 appears in our catalog under these names: 4-Amino-n-(2-furylmethyl)-1-methyl-1h-pyrazole-5-carboxamide, 95%, 4-Amino-N-(furan-2-ylmethyl)-1-methyl-1H-pyrazole-5-carboxamide, 97%, 4-Amino-N-(furan-2-ylmethyl)-1-methyl-1H-pyrazole-5-carboxamide 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 50mg, 100mg.
4-amino-N-(furan-2-ylmethyl)-1-methylpyrazole-5-carboxamide (CAS 1001500-15-7) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 4-amino-N-(furan-2-ylmethyl)-1-methylpyrazole-5-carboxamide. InChIKey: YGKNAAQUXZMNKO-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 4-amino-N-(furan-2-ylmethyl)-1-methylpyrazole-5-carboxamide |
| InChIKey | YGKNAAQUXZMNKO-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)N)C(=O)NCC2=CC=CO2 |
Computed by PubChem (NCBI)