CAS 1573548-47-6 appears in our catalog under these names: 6-Amino-3-(2-methoxyethyl)-3,4-dihydro-1,2,3-benzotriazin-4-one, 95%, 6-Amino-3-(2-methoxyethyl)-3,4-dihydro-1,2,3-benzotriazin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 0,5g.
6-amino-3-(2-methoxyethyl)-1,2,3-benzotriazin-4-one (CAS 1573548-47-6) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 6-amino-3-(2-methoxyethyl)-1,2,3-benzotriazin-4-one. InChIKey: NAQZDRVFKJGEHP-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 6-amino-3-(2-methoxyethyl)-1,2,3-benzotriazin-4-one |
| InChIKey | NAQZDRVFKJGEHP-UHFFFAOYSA-N |
| SMILES | COCCN1C(=O)C2=C(C=CC(=C2)N)N=N1 |
Computed by PubChem (NCBI)