CAS 1160263-99-9 appears in our catalog under these names: 4-(3-Aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione, 95%, 4-(3-Aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(3-aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione (CAS 1160263-99-9) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 4-(3-aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione. InChIKey: LABROZRLPSCPEO-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 4-(3-aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione |
| InChIKey | LABROZRLPSCPEO-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C(=O)N1C)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)